C23H38O6 — CID 174499286
1-O-nonyl 2-O-propan-2-yl 1-prop-2-enoyloxycyclohexane-1,2-dicarboxylate (PubChem CID 174499286) has the molecular formula C23H38O6 and a molecular weight of 410.55 g/mol. Its IUPAC name is 1-O-nonyl 2-O-propan-2-yl 1-prop-2-enoyloxycyclohexane-1,2-dicarboxylate.
| Compound Name | 1-O-nonyl 2-O-propan-2-yl 1-prop-2-enoyloxycyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 174499286 |
| Molecular Formula | C23H38O6 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | 1-O-nonyl 2-O-propan-2-yl 1-prop-2-enoyloxycyclohexane-1,2-dicarboxylate |
| SMILES | C=CC(=O)OC1(C(=O)OCCCCCCCCC)CCCCC1C(=O)OC(C)C |
| InChI | InChI=1S/C23H38O6/c1-5-7-8-9-10-11-14-17-27-22(26)23(29-20(24)6-2)16-13-12-15-19(23)21(25)28-18(3)4/h6,18-19H,2,5,7-17H2,1,3-4H3 |
| InChIKey | OVGYUDZEZOJXFY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|