C22H36O6 — CID 174485167
1-O-octyl 2-O-propan-2-yl 1-prop-2-enoyloxycyclohexane-1,2-dicarboxylate (PubChem CID 174485167) has the molecular formula C22H36O6 and a molecular weight of 396.52 g/mol. Its IUPAC name is 1-O-octyl 2-O-propan-2-yl 1-prop-2-enoyloxycyclohexane-1,2-dicarboxylate.
| Compound Name | 1-O-octyl 2-O-propan-2-yl 1-prop-2-enoyloxycyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 174485167 |
| Molecular Formula | C22H36O6 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 1-O-octyl 2-O-propan-2-yl 1-prop-2-enoyloxycyclohexane-1,2-dicarboxylate |
| SMILES | C=CC(=O)OC1(C(=O)OCCCCCCCC)CCCCC1C(=O)OC(C)C |
| InChI | InChI=1S/C22H36O6/c1-5-7-8-9-10-13-16-26-21(25)22(28-19(23)6-2)15-12-11-14-18(22)20(24)27-17(3)4/h6,17-18H,2,5,7-16H2,1,3-4H3 |
| InChIKey | VDTXLVIWKAOMAN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|