C19H39NO2 — CID 70171586
1,2-dibutylcycloheptane-1-carboxylic acid;N-methylethanamine (PubChem CID 70171586) has the molecular formula C19H39NO2 and a molecular weight of 313.53 g/mol. Its IUPAC name is 1,2-dibutylcycloheptane-1-carboxylic acid;N-methylethanamine.
| Compound Name | 1,2-dibutylcycloheptane-1-carboxylic acid;N-methylethanamine |
|---|---|
| PubChem CID | 70171586 |
| Molecular Formula | C19H39NO2 |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.30 |
| IUPAC Name | 1,2-dibutylcycloheptane-1-carboxylic acid;N-methylethanamine |
| SMILES | CCCCC1CCCCCC1(CCCC)C(=O)O.CCNC |
| InChI | InChI=1S/C16H30O2.C3H9N/c1-3-5-10-14-11-8-7-9-13-16(14,15(17)18)12-6-4-2;1-3-4-2/h14H,3-13H2,1-2H3,(H,17,18);4H,3H2,1-2H3 |
| InChIKey | BVVVVUZCTZJABN-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |