C6H6N2O3 — CID 141247355
3-methyl-2,6-dioxopyrimidine-4-carbaldehyde (PubChem CID 141247355) has the molecular formula C6H6N2O3 and a molecular weight of 154.12 g/mol. Its IUPAC name is 3-methyl-2,6-dioxopyrimidine-4-carbaldehyde.
| Compound Name | 3-methyl-2,6-dioxopyrimidine-4-carbaldehyde |
|---|---|
| PubChem CID | 141247355 |
| Molecular Formula | C6H6N2O3 |
| Molecular Weight | 154.12 g/mol |
| Exact Mass | 154.04 |
| IUPAC Name | 3-methyl-2,6-dioxopyrimidine-4-carbaldehyde |
| SMILES | Cn1c(C=O)cc(=O)[nH]c1=O |
| InChI | InChI=1S/C6H6N2O3/c1-8-4(3-9)2-5(10)7-6(8)11/h2-3H,1H3,(H,7,10,11) |
| InChIKey | CKNNTNBITXIYHJ-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.12 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|