C30H31N3O2 — CID 141248188
N-[(3R)-1-(2,3-dimethyl-6-phenylbenzoyl)piperidin-3-yl]-1-methylindole-3-carboxamide (PubChem CID 141248188) has the molecular formula C30H31N3O2 and a molecular weight of 465.60 g/mol. Its IUPAC name is N-[(3R)-1-(2,3-dimethyl-6-phenylbenzoyl)piperidin-3-yl]-1-methylindole-3-carboxamide.
| Compound Name | N-[(3R)-1-(2,3-dimethyl-6-phenylbenzoyl)piperidin-3-yl]-1-methylindole-3-carboxamide |
|---|---|
| PubChem CID | 141248188 |
| Molecular Formula | C30H31N3O2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | N-[(3R)-1-(2,3-dimethyl-6-phenylbenzoyl)piperidin-3-yl]-1-methylindole-3-carboxamide |
| SMILES | Cc1ccc(-c2ccccc2)c(C(=O)N2CCC[C@@H](NC(=O)c3cn(C)c4ccccc34)C2)c1C |
| InChI | InChI=1S/C30H31N3O2/c1-20-15-16-24(22-10-5-4-6-11-22)28(21(20)2)30(35)33-17-9-12-23(18-33)31-29(34)26-19-32(3)27-14-8-7-13-25(26)27/h4-8,10-11,13-16,19,23H,9,12,17-18H2,1-3H3,(H,31,34)/t23-/m1/s1 |
| InChIKey | FVSCAAOUSMIDDH-HSZRJFAPSA-N |
| XLogP | 5.50 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |