C21H27FN4O — CID 141248203
(3aS,6aR)-3-tert-butyl-5-[6-[(4-fluorophenyl)methoxy]pyrazin-2-yl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 141248203) has the molecular formula C21H27FN4O and a molecular weight of 370.47 g/mol. Its IUPAC name is (3aS,6aR)-3-tert-butyl-5-[6-[(4-fluorophenyl)methoxy]pyrazin-2-yl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | (3aS,6aR)-3-tert-butyl-5-[6-[(4-fluorophenyl)methoxy]pyrazin-2-yl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 141248203 |
| Molecular Formula | C21H27FN4O |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | (3aS,6aR)-3-tert-butyl-5-[6-[(4-fluorophenyl)methoxy]pyrazin-2-yl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | CC(C)(C)C1NC[C@@H]2CN(c3cncc(OCc4ccc(F)cc4)n3)C[C@@H]12 |
| InChI | InChI=1S/C21H27FN4O/c1-21(2,3)20-17-12-26(11-15(17)8-24-20)18-9-23-10-19(25-18)27-13-14-4-6-16(22)7-5-14/h4-7,9-10,15,17,20,24H,8,11-13H2,1-3H3/t15-,17-,20?/m1/s1 |
| InChIKey | JGLBDSFMMNVSHR-LSOHHRALSA-N |
| XLogP | 3.27 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |