C21H22N2O3 — CID 141249488
(E)-N-hydroxy-3-[4-[(2S)-1-phenacylpyrrolidin-2-yl]phenyl]prop-2-enamide (PubChem CID 141249488) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[4-[(2S)-1-phenacylpyrrolidin-2-yl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[4-[(2S)-1-phenacylpyrrolidin-2-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 141249488 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (E)-N-hydroxy-3-[4-[(2S)-1-phenacylpyrrolidin-2-yl]phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc([C@@H]2CCCN2CC(=O)c2ccccc2)cc1)NO |
| InChI | InChI=1S/C21H22N2O3/c24-20(18-5-2-1-3-6-18)15-23-14-4-7-19(23)17-11-8-16(9-12-17)10-13-21(25)22-26/h1-3,5-6,8-13,19,26H,4,7,14-15H2,(H,22,25)/b13-10+/t19-/m0/s1 |
| InChIKey | GOQWSWMYSLZRBD-QHSLDKKCSA-N |
| XLogP | 3.22 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|