C24H34N4O2 — CID 91470771
3-[4-[(2S)-1-[2-(1-tert-butyl-3,5-dimethylpyrazol-4-yl)ethyl]pyrrolidin-2-yl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 91470771) has the molecular formula C24H34N4O2 and a molecular weight of 410.56 g/mol. Its IUPAC name is 3-[4-[(2S)-1-[2-(1-tert-butyl-3,5-dimethylpyrazol-4-yl)ethyl]pyrrolidin-2-yl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[4-[(2S)-1-[2-(1-tert-butyl-3,5-dimethylpyrazol-4-yl)ethyl]pyrrolidin-2-yl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 91470771 |
| Molecular Formula | C24H34N4O2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | 3-[4-[(2S)-1-[2-(1-tert-butyl-3,5-dimethylpyrazol-4-yl)ethyl]pyrrolidin-2-yl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | Cc1nn(C(C)(C)C)c(C)c1CCN1CCC[C@H]1c1ccc(C=CC(=O)NO)cc1 |
| InChI | InChI=1S/C24H34N4O2/c1-17-21(18(2)28(25-17)24(3,4)5)14-16-27-15-6-7-22(27)20-11-8-19(9-12-20)10-13-23(29)26-30/h8-13,22,30H,6-7,14-16H2,1-5H3,(H,26,29)/t22-/m0/s1 |
| InChIKey | PBCVNGKPXAQQOM-QFIPXVFZSA-N |
| XLogP | 4.15 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|