C20H28N6O2 — CID 76728718
3-[4-[1-[2-(2-tert-butyltetrazol-5-yl)ethyl]pyrrolidin-2-yl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 76728718) has the molecular formula C20H28N6O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 3-[4-[1-[2-(2-tert-butyltetrazol-5-yl)ethyl]pyrrolidin-2-yl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[4-[1-[2-(2-tert-butyltetrazol-5-yl)ethyl]pyrrolidin-2-yl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 76728718 |
| Molecular Formula | C20H28N6O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 3-[4-[1-[2-(2-tert-butyltetrazol-5-yl)ethyl]pyrrolidin-2-yl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | CC(C)(C)n1nnc(CCN2CCCC2c2ccc(C=CC(=O)NO)cc2)n1 |
| InChI | InChI=1S/C20H28N6O2/c1-20(2,3)26-22-18(21-24-26)12-14-25-13-4-5-17(25)16-9-6-15(7-10-16)8-11-19(27)23-28/h6-11,17,28H,4-5,12-14H2,1-3H3,(H,23,27) |
| InChIKey | AMILFESRAIOHJE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|