C24H32N4O2 — CID 74960086
3-[4-[1-[2-[1-(cyclopropylmethyl)-3,5-dimethylpyrazol-4-yl]ethyl]pyrrolidin-2-yl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 74960086) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 3-[4-[1-[2-[1-(cyclopropylmethyl)-3,5-dimethylpyrazol-4-yl]ethyl]pyrrolidin-2-yl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[4-[1-[2-[1-(cyclopropylmethyl)-3,5-dimethylpyrazol-4-yl]ethyl]pyrrolidin-2-yl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 74960086 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 3-[4-[1-[2-[1-(cyclopropylmethyl)-3,5-dimethylpyrazol-4-yl]ethyl]pyrrolidin-2-yl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | Cc1nn(CC2CC2)c(C)c1CCN1CCCC1c1ccc(C=CC(=O)NO)cc1 |
| InChI | InChI=1S/C24H32N4O2/c1-17-22(18(2)28(25-17)16-20-5-6-20)13-15-27-14-3-4-23(27)21-10-7-19(8-11-21)9-12-24(29)26-30/h7-12,20,23,30H,3-6,13-16H2,1-2H3,(H,26,29) |
| InChIKey | WHDNQTGPNIXDRG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|