C11H11F3N2O3S — CID 141252312
6-propylsulfonyl-5-(trifluoromethoxy)-1H-benzimidazole (PubChem CID 141252312) has the molecular formula C11H11F3N2O3S and a molecular weight of 308.28 g/mol. Its IUPAC name is 6-propylsulfonyl-5-(trifluoromethoxy)-1H-benzimidazole.
| Compound Name | 6-propylsulfonyl-5-(trifluoromethoxy)-1H-benzimidazole |
|---|---|
| PubChem CID | 141252312 |
| Molecular Formula | C11H11F3N2O3S |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 6-propylsulfonyl-5-(trifluoromethoxy)-1H-benzimidazole |
| SMILES | CCCS(=O)(=O)c1cc2[nH]cnc2cc1OC(F)(F)F |
| InChI | InChI=1S/C11H11F3N2O3S/c1-2-3-20(17,18)10-5-8-7(15-6-16-8)4-9(10)19-11(12,13)14/h4-6H,2-3H2,1H3,(H,15,16) |
| InChIKey | AGUBJSAQFALKBO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |