C13H11N5 — CID 141253813
2-methyl-5-(3-pyridin-3-yl-1H-pyrazol-5-yl)pyrazine (PubChem CID 141253813) has the molecular formula C13H11N5 and a molecular weight of 237.27 g/mol. Its IUPAC name is 2-methyl-5-(3-pyridin-3-yl-1H-pyrazol-5-yl)pyrazine.
| Compound Name | 2-methyl-5-(3-pyridin-3-yl-1H-pyrazol-5-yl)pyrazine |
|---|---|
| PubChem CID | 141253813 |
| Molecular Formula | C13H11N5 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2-methyl-5-(3-pyridin-3-yl-1H-pyrazol-5-yl)pyrazine |
| SMILES | Cc1cnc(-c2cc(-c3cccnc3)n[nH]2)cn1 |
| InChI | InChI=1S/C13H11N5/c1-9-6-16-13(8-15-9)12-5-11(17-18-12)10-3-2-4-14-7-10/h2-8H,1H3,(H,17,18) |
| InChIKey | FCXILHRNWBLDOF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |