C14H8F3N3 — CID 141253718
3-[3-(3,4,5-trifluorophenyl)-1H-pyrazol-5-yl]pyridine (PubChem CID 141253718) has the molecular formula C14H8F3N3 and a molecular weight of 275.23 g/mol. Its IUPAC name is 3-[3-(3,4,5-trifluorophenyl)-1H-pyrazol-5-yl]pyridine.
| Compound Name | 3-[3-(3,4,5-trifluorophenyl)-1H-pyrazol-5-yl]pyridine |
|---|---|
| PubChem CID | 141253718 |
| Molecular Formula | C14H8F3N3 |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 3-[3-(3,4,5-trifluorophenyl)-1H-pyrazol-5-yl]pyridine |
| SMILES | Fc1cc(-c2cc(-c3cccnc3)[nH]n2)cc(F)c1F |
| InChI | InChI=1S/C14H8F3N3/c15-10-4-9(5-11(16)14(10)17)13-6-12(19-20-13)8-2-1-3-18-7-8/h1-7H,(H,19,20) |
| InChIKey | VWXYAJHYKJMGIG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|