C13H7F3N4 — CID 141253732
5-[5-(2,3,6-trifluorophenyl)-1H-pyrazol-3-yl]pyrimidine (PubChem CID 141253732) has the molecular formula C13H7F3N4 and a molecular weight of 276.22 g/mol. Its IUPAC name is 5-[5-(2,3,6-trifluorophenyl)-1H-pyrazol-3-yl]pyrimidine.
| Compound Name | 5-[5-(2,3,6-trifluorophenyl)-1H-pyrazol-3-yl]pyrimidine |
|---|---|
| PubChem CID | 141253732 |
| Molecular Formula | C13H7F3N4 |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 5-[5-(2,3,6-trifluorophenyl)-1H-pyrazol-3-yl]pyrimidine |
| SMILES | Fc1ccc(F)c(-c2cc(-c3cncnc3)n[nH]2)c1F |
| InChI | InChI=1S/C13H7F3N4/c14-8-1-2-9(15)13(16)12(8)11-3-10(19-20-11)7-4-17-6-18-5-7/h1-6H,(H,19,20) |
| InChIKey | VDDJPLVZPZOPPH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|