C16H12N2O8S — CID 141253974
2-amino-5-(4-amino-3,5-dicarboxyphenyl)sulfanylbenzene-1,3-dicarboxylic acid (PubChem CID 141253974) has the molecular formula C16H12N2O8S and a molecular weight of 392.35 g/mol. Its IUPAC name is 2-amino-5-(4-amino-3,5-dicarboxyphenyl)sulfanylbenzene-1,3-dicarboxylic acid.
| Compound Name | 2-amino-5-(4-amino-3,5-dicarboxyphenyl)sulfanylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 141253974 |
| Molecular Formula | C16H12N2O8S |
| Molecular Weight | 392.35 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | 2-amino-5-(4-amino-3,5-dicarboxyphenyl)sulfanylbenzene-1,3-dicarboxylic acid |
| SMILES | Nc1c(C(=O)O)cc(Sc2cc(C(=O)O)c(N)c(C(=O)O)c2)cc1C(=O)O |
| InChI | InChI=1S/C16H12N2O8S/c17-11-7(13(19)20)1-5(2-8(11)14(21)22)27-6-3-9(15(23)24)12(18)10(4-6)16(25)26/h1-4H,17-18H2,(H,19,20)(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | TWVYSLDGXHXVKT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 201.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|