About 5-(2,3-dichlorophenyl)-2-[(3,5-dichlorophenyl)methyl]-1H-imidazole
5-(2,3-dichlorophenyl)-2-[(3,5-dichlorophenyl)methyl]-1H-imidazole (PubChem CID 141255824) has the molecular formula C16H10Cl4N2
and a molecular weight of 372.08 g/mol. Its IUPAC name is 5-(2,3-dichlorophenyl)-2-[(3,5-dichlorophenyl)methyl]-1H-imidazole.
Molecular Properties
| Compound Name | 5-(2,3-dichlorophenyl)-2-[(3,5-dichlorophenyl)methyl]-1H-imidazole |
| PubChem CID | 141255824 |
| Molecular Formula | C16H10Cl4N2 |
| Molecular Weight | 372.08 g/mol |
| Exact Mass | 369.96 |
| IUPAC Name | 5-(2,3-dichlorophenyl)-2-[(3,5-dichlorophenyl)methyl]-1H-imidazole |
| SMILES | Clc1cc(Cl)cc(Cc2ncc(-c3cccc(Cl)c3Cl)[nH]2)c1 |
| InChI | InChI=1S/C16H10Cl4N2/c17-10-4-9(5-11(18)7-10)6-15-21-8-14(22-15)12-2-1-3-13(19)16(12)20/h1-5,7-8H,6H2,(H,21,22) |
| InChIKey | GNCISOVIMJIVEI-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.08 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(2,3-dichlorophenyl)-2-[(3,5-dichlorophenyl)methyl]-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,3-dichlorophenyl)-2-[(3,5-dichlorophenyl)methyl]-1H-imidazole?
The IUPAC name of 5-(2,3-dichlorophenyl)-2-[(3,5-dichlorophenyl)methyl]-1H-imidazole (CID 141255824) is 5-(2,3-dichlorophenyl)-2-[(3,5-dichlorophenyl)methyl]-1H-imidazole.
What is the SMILES notation for 5-(2,3-dichlorophenyl)-2-[(3,5-dichlorophenyl)methyl]-1H-imidazole?
The canonical SMILES for 5-(2,3-dichlorophenyl)-2-[(3,5-dichlorophenyl)methyl]-1H-imidazole is Clc1cc(Cl)cc(Cc2ncc(-c3cccc(Cl)c3Cl)[nH]2)c1.
What is the InChIKey of 5-(2,3-dichlorophenyl)-2-[(3,5-dichlorophenyl)methyl]-1H-imidazole?
The InChIKey is GNCISOVIMJIVEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10Cl4N2/c17-10-4-9(5-11(18)7-10)6-15-21-8-14(22-15)12-2-1-3-13(19)16(12)20/h1-5,7-8H,6H2,(H,21,22).
What are the key properties of 5-(2,3-dichlorophenyl)-2-[(3,5-dichlorophenyl)methyl]-1H-imidazole?
5-(2,3-dichlorophenyl)-2-[(3,5-dichlorophenyl)methyl]-1H-imidazole has a molecular weight of 372.08 g/mol, XLogP of 6.28, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,3-dichlorophenyl)-2-[(3,5-dichlorophenyl)methyl]-1H-imidazole is sourced from PubChem (CID 141255824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).