C16H8Cl6N2 — CID 141255867
5-(2,4,5-trichlorophenyl)-2-[(3,4,5-trichlorophenyl)methyl]-1H-imidazole (PubChem CID 141255867) has the molecular formula C16H8Cl6N2 and a molecular weight of 440.97 g/mol. Its IUPAC name is 5-(2,4,5-trichlorophenyl)-2-[(3,4,5-trichlorophenyl)methyl]-1H-imidazole.
| Compound Name | 5-(2,4,5-trichlorophenyl)-2-[(3,4,5-trichlorophenyl)methyl]-1H-imidazole |
|---|---|
| PubChem CID | 141255867 |
| Molecular Formula | C16H8Cl6N2 |
| Molecular Weight | 440.97 g/mol |
| Exact Mass | 437.88 |
| IUPAC Name | 5-(2,4,5-trichlorophenyl)-2-[(3,4,5-trichlorophenyl)methyl]-1H-imidazole |
| SMILES | Clc1cc(Cl)c(-c2cnc(Cc3cc(Cl)c(Cl)c(Cl)c3)[nH]2)cc1Cl |
| InChI | InChI=1S/C16H8Cl6N2/c17-9-5-11(19)10(18)4-8(9)14-6-23-15(24-14)3-7-1-12(20)16(22)13(21)2-7/h1-2,4-6H,3H2,(H,23,24) |
| InChIKey | SIEUWXICSQXSAB-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.97 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|