C17H12Cl4N2 — CID 141255861
2-[(2-chlorophenyl)methyl]-5-methyl-4-(2,4,5-trichlorophenyl)-1H-imidazole (PubChem CID 141255861) has the molecular formula C17H12Cl4N2 and a molecular weight of 386.11 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl]-5-methyl-4-(2,4,5-trichlorophenyl)-1H-imidazole.
| Compound Name | 2-[(2-chlorophenyl)methyl]-5-methyl-4-(2,4,5-trichlorophenyl)-1H-imidazole |
|---|---|
| PubChem CID | 141255861 |
| Molecular Formula | C17H12Cl4N2 |
| Molecular Weight | 386.11 g/mol |
| Exact Mass | 383.98 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl]-5-methyl-4-(2,4,5-trichlorophenyl)-1H-imidazole |
| SMILES | Cc1[nH]c(Cc2ccccc2Cl)nc1-c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H12Cl4N2/c1-9-17(11-7-14(20)15(21)8-13(11)19)23-16(22-9)6-10-4-2-3-5-12(10)18/h2-5,7-8H,6H2,1H3,(H,22,23) |
| InChIKey | UMQKDHUYGHLCIS-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.11 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|