C16H22O7S2 — CID 141256323
5-(4-carboxybutylsulfanyl)-2-phenyl-2-sulfopentanoic acid (PubChem CID 141256323) has the molecular formula C16H22O7S2 and a molecular weight of 390.48 g/mol. Its IUPAC name is 5-(4-carboxybutylsulfanyl)-2-phenyl-2-sulfopentanoic acid.
| Compound Name | 5-(4-carboxybutylsulfanyl)-2-phenyl-2-sulfopentanoic acid |
|---|---|
| PubChem CID | 141256323 |
| Molecular Formula | C16H22O7S2 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 5-(4-carboxybutylsulfanyl)-2-phenyl-2-sulfopentanoic acid |
| SMILES | O=C(O)CCCCSCCCC(C(=O)O)(c1ccccc1)S(=O)(=O)O |
| InChI | InChI=1S/C16H22O7S2/c17-14(18)9-4-5-11-24-12-6-10-16(15(19)20,25(21,22)23)13-7-2-1-3-8-13/h1-3,7-8H,4-6,9-12H2,(H,17,18)(H,19,20)(H,21,22,23) |
| InChIKey | IXLAUUAYCNVANX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|