C16H27N3O5 — CID 141256877
methyl (2S,3R,4S)-3-acetamido-4-amino-2-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 141256877) has the molecular formula C16H27N3O5 and a molecular weight of 341.41 g/mol. Its IUPAC name is methyl (2S,3R,4S)-3-acetamido-4-amino-2-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (2S,3R,4S)-3-acetamido-4-amino-2-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 141256877 |
| Molecular Formula | C16H27N3O5 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | methyl (2S,3R,4S)-3-acetamido-4-amino-2-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | COC(=O)C1=C[C@H](N)[C@@H](NC(C)=O)[C@H](CN2C[C@@H](C)O[C@@H](C)C2)O1 |
| InChI | InChI=1S/C16H27N3O5/c1-9-6-19(7-10(2)23-9)8-14-15(18-11(3)20)12(17)5-13(24-14)16(21)22-4/h5,9-10,12,14-15H,6-8,17H2,1-4H3,(H,18,20)/t9-,10+,12-,14-,15+/m0/s1 |
| InChIKey | OMVCOSIEUKEUTQ-VZBCLDGYSA-N |
| XLogP | -0.62 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |