C16H24F3N3O5 — CID 86754853
methyl (2R,3R,4S)-4-amino-2-(dipropylcarbamoyl)-3-[(2,2,2-trifluoroacetyl)amino]-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 86754853) has the molecular formula C16H24F3N3O5 and a molecular weight of 395.38 g/mol. Its IUPAC name is methyl (2R,3R,4S)-4-amino-2-(dipropylcarbamoyl)-3-[(2,2,2-trifluoroacetyl)amino]-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (2R,3R,4S)-4-amino-2-(dipropylcarbamoyl)-3-[(2,2,2-trifluoroacetyl)amino]-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 86754853 |
| Molecular Formula | C16H24F3N3O5 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | methyl (2R,3R,4S)-4-amino-2-(dipropylcarbamoyl)-3-[(2,2,2-trifluoroacetyl)amino]-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | CCCN(CCC)C(=O)[C@@H]1OC(C(=O)OC)=C[C@H](N)[C@H]1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C16H24F3N3O5/c1-4-6-22(7-5-2)13(23)12-11(21-15(25)16(17,18)19)9(20)8-10(27-12)14(24)26-3/h8-9,11-12H,4-7,20H2,1-3H3,(H,21,25)/t9-,11+,12+/m0/s1 |
| InChIKey | JPDHVYJQDKVYGG-MVWJERBFSA-N |
| XLogP | 0.47 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |