C20H30O4S — CID 141260528
[2-methyl-1-phenyl-1-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)propan-2-yl] hydrogen sulfate (PubChem CID 141260528) has the molecular formula C20H30O4S and a molecular weight of 366.52 g/mol. Its IUPAC name is [2-methyl-1-phenyl-1-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)propan-2-yl] hydrogen sulfate.
| Compound Name | [2-methyl-1-phenyl-1-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)propan-2-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 141260528 |
| Molecular Formula | C20H30O4S |
| Molecular Weight | 366.52 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | [2-methyl-1-phenyl-1-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)propan-2-yl] hydrogen sulfate |
| SMILES | CC(C)(OS(=O)(=O)O)C(c1ccccc1)C1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C20H30O4S/c1-18(2)15-11-12-20(18,5)16(13-15)17(14-9-7-6-8-10-14)19(3,4)24-25(21,22)23/h6-10,15-17H,11-13H2,1-5H3,(H,21,22,23) |
| InChIKey | HEOWFOQFNHBMDU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|