C20H28O2S — CID 101114412
(E,2R)-2-phenyl-4-[[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]sulfinyl]but-3-en-2-ol (PubChem CID 101114412) has the molecular formula C20H28O2S and a molecular weight of 332.51 g/mol. Its IUPAC name is (E,2R)-2-phenyl-4-[[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]sulfinyl]but-3-en-2-ol.
| Compound Name | (E,2R)-2-phenyl-4-[[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]sulfinyl]but-3-en-2-ol |
|---|---|
| PubChem CID | 101114412 |
| Molecular Formula | C20H28O2S |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | (E,2R)-2-phenyl-4-[[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]sulfinyl]but-3-en-2-ol |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)[C@@H](S(=O)/C=C/[C@@](C)(O)c1ccccc1)C2 |
| InChI | InChI=1S/C20H28O2S/c1-18(2)16-10-11-19(18,3)17(14-16)23(22)13-12-20(4,21)15-8-6-5-7-9-15/h5-9,12-13,16-17,21H,10-11,14H2,1-4H3/b13-12+/t16-,17-,19+,20+,23?/m0/s1 |
| InChIKey | RYXFRAZWIMFPDS-BWLADCOYSA-N |
| XLogP | 4.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |