C19H24O2S — CID 101114404
(E)-1-phenyl-3-[[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]sulfinyl]prop-2-en-1-one (PubChem CID 101114404) has the molecular formula C19H24O2S and a molecular weight of 316.47 g/mol. Its IUPAC name is (E)-1-phenyl-3-[[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]sulfinyl]prop-2-en-1-one.
| Compound Name | (E)-1-phenyl-3-[[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]sulfinyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 101114404 |
| Molecular Formula | C19H24O2S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (E)-1-phenyl-3-[[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]sulfinyl]prop-2-en-1-one |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)[C@@H](S(=O)/C=C/C(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C19H24O2S/c1-18(2)15-9-11-19(18,3)17(13-15)22(21)12-10-16(20)14-7-5-4-6-8-14/h4-8,10,12,15,17H,9,11,13H2,1-3H3/b12-10+/t15-,17-,19+,22?/m0/s1 |
| InChIKey | DHHKLFRRCHWLQR-MYIKKANDSA-N |
| XLogP | 4.35 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|