C10H18O2S — CID 14705512
1,7,7-trimethylbicyclo[2.2.1]heptane-2-sulfinic acid (PubChem CID 14705512) has the molecular formula C10H18O2S and a molecular weight of 202.32 g/mol. Its IUPAC name is 1,7,7-trimethylbicyclo[2.2.1]heptane-2-sulfinic acid.
| Compound Name | 1,7,7-trimethylbicyclo[2.2.1]heptane-2-sulfinic acid |
|---|---|
| PubChem CID | 14705512 |
| Molecular Formula | C10H18O2S |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 1,7,7-trimethylbicyclo[2.2.1]heptane-2-sulfinic acid |
| SMILES | CC1(C)C2CCC1(C)C(S(=O)O)C2 |
| InChI | InChI=1S/C10H18O2S/c1-9(2)7-4-5-10(9,3)8(6-7)13(11)12/h7-8H,4-6H2,1-3H3,(H,11,12) |
| InChIKey | MDZZELJFEAMOAP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|