C37H26N6OS2 — CID 141260624
2-[4-(1H-benzimidazol-2-yl)-2-(furan-2-yl)-3-naphthalen-1-yl-1-phenylsulfanyl-5-(1H-pyrazol-5-yl)-3H-pyrrol-2-yl]-1,3-thiazole (PubChem CID 141260624) has the molecular formula C37H26N6OS2 and a molecular weight of 634.79 g/mol. Its IUPAC name is 2-[4-(1H-benzimidazol-2-yl)-2-(furan-2-yl)-3-naphthalen-1-yl-1-phenylsulfanyl-5-(1H-pyrazol-5-yl)-3H-pyrrol-2-yl]-1,3-thiazole.
| Compound Name | 2-[4-(1H-benzimidazol-2-yl)-2-(furan-2-yl)-3-naphthalen-1-yl-1-phenylsulfanyl-5-(1H-pyrazol-5-yl)-3H-pyrrol-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 141260624 |
| Molecular Formula | C37H26N6OS2 |
| Molecular Weight | 634.79 g/mol |
| Exact Mass | 634.16 |
| IUPAC Name | 2-[4-(1H-benzimidazol-2-yl)-2-(furan-2-yl)-3-naphthalen-1-yl-1-phenylsulfanyl-5-(1H-pyrazol-5-yl)-3H-pyrrol-2-yl]-1,3-thiazole |
| SMILES | c1ccc(SN2C(c3ccn[nH]3)=C(c3nc4ccccc4[nH]3)C(c3cccc4ccccc34)C2(c2ccco2)c2nccs2)cc1 |
| InChI | InChI=1S/C37H26N6OS2/c1-2-12-25(13-3-1)46-43-34(30-19-20-39-42-30)32(35-40-28-16-6-7-17-29(28)41-35)33(27-15-8-11-24-10-4-5-14-26(24)27)37(43,31-18-9-22-44-31)36-38-21-23-45-36/h1-23,33H,(H,39,42)(H,40,41) |
| InChIKey | OECGSICCHKWQDF-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.79 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|