ethyl 2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate

C12H12FNO2S — CID 141260677

IUPACethyl 2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate
SMILESCCOC(=O)C1CSC(c2ccc(F)cc2)=N1
InChIInChI=1S/C12H12FNO2S/c1-2-16-12(15)10-7-17-11(14-10)8-3-5-9(13)6-4-8/h3-6,10H,2,7H2,1H3
InChIKeyNNLZINVAHHFQDD-UHFFFAOYSA-N
MW253.30 g/mol
LogP2.25
Rot. Bonds3

About ethyl 2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate

ethyl 2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate (PubChem CID 141260677) has the molecular formula C12H12FNO2S and a molecular weight of 253.30 g/mol. Its IUPAC name is ethyl 2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate.

Molecular Properties

Compound Nameethyl 2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate
PubChem CID141260677
Molecular FormulaC12H12FNO2S
Molecular Weight253.30 g/mol
Exact Mass253.06
IUPAC Nameethyl 2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate
SMILESCCOC(=O)C1CSC(c2ccc(F)cc2)=N1
InChIInChI=1S/C12H12FNO2S/c1-2-16-12(15)10-7-17-11(14-10)8-3-5-9(13)6-4-8/h3-6,10H,2,7H2,1H3
InChIKeyNNLZINVAHHFQDD-UHFFFAOYSA-N
XLogP2.25
TPSA38.66 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.30
LogP ≤ 52.25
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze ethyl 2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate?
The IUPAC name of ethyl 2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate (CID 141260677) is ethyl 2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate.
What is the SMILES notation for ethyl 2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate?
The canonical SMILES for ethyl 2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate is CCOC(=O)C1CSC(c2ccc(F)cc2)=N1.
What is the InChIKey of ethyl 2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate?
The InChIKey is NNLZINVAHHFQDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12FNO2S/c1-2-16-12(15)10-7-17-11(14-10)8-3-5-9(13)6-4-8/h3-6,10H,2,7H2,1H3.
What are the key properties of ethyl 2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate?
ethyl 2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate has a molecular weight of 253.30 g/mol, XLogP of 2.25, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 141260677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).