C12H13NOS2 — CID 11010427
4-(2-methylsulfanylethyl)-2-phenyl-4H-1,3-thiazol-5-one (PubChem CID 11010427) has the molecular formula C12H13NOS2 and a molecular weight of 251.38 g/mol. Its IUPAC name is 4-(2-methylsulfanylethyl)-2-phenyl-4H-1,3-thiazol-5-one.
| Compound Name | 4-(2-methylsulfanylethyl)-2-phenyl-4H-1,3-thiazol-5-one |
|---|---|
| PubChem CID | 11010427 |
| Molecular Formula | C12H13NOS2 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 4-(2-methylsulfanylethyl)-2-phenyl-4H-1,3-thiazol-5-one |
| SMILES | CSCCC1N=C(c2ccccc2)SC1=O |
| InChI | InChI=1S/C12H13NOS2/c1-15-8-7-10-12(14)16-11(13-10)9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3 |
| InChIKey | BFIZDULHDSYOCZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|