C26H29FN4O3 — CID 141261022
(1R,3R,4R)-4-[1-[6-fluoro-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)quinolin-8-yl]oxy-2-methylpropan-2-yl]-2,2-dimethylcyclopentane-1,3-diol (PubChem CID 141261022) has the molecular formula C26H29FN4O3 and a molecular weight of 464.54 g/mol. Its IUPAC name is (1R,3R,4R)-4-[1-[6-fluoro-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)quinolin-8-yl]oxy-2-methylpropan-2-yl]-2,2-dimethylcyclopentane-1,3-diol.
| Compound Name | (1R,3R,4R)-4-[1-[6-fluoro-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)quinolin-8-yl]oxy-2-methylpropan-2-yl]-2,2-dimethylcyclopentane-1,3-diol |
|---|---|
| PubChem CID | 141261022 |
| Molecular Formula | C26H29FN4O3 |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | (1R,3R,4R)-4-[1-[6-fluoro-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)quinolin-8-yl]oxy-2-methylpropan-2-yl]-2,2-dimethylcyclopentane-1,3-diol |
| SMILES | CC(C)(COc1cc(F)cc2ccc(-c3nnc4ccccn34)nc12)[C@H]1C[C@@H](O)C(C)(C)[C@@H]1O |
| InChI | InChI=1S/C26H29FN4O3/c1-25(2,17-13-20(32)26(3,4)23(17)33)14-34-19-12-16(27)11-15-8-9-18(28-22(15)19)24-30-29-21-7-5-6-10-31(21)24/h5-12,17,20,23,32-33H,13-14H2,1-4H3/t17-,20+,23+/m0/s1 |
| InChIKey | SOLFGIMUGQUULC-XTQVGHSUSA-N |
| XLogP | 4.26 |
| TPSA | 92.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |