C15H32O2 — CID 141261588
2,6,6,10-tetramethylundecane-5,5-diol (PubChem CID 141261588) has the molecular formula C15H32O2 and a molecular weight of 244.42 g/mol. Its IUPAC name is 2,6,6,10-tetramethylundecane-5,5-diol.
| Compound Name | 2,6,6,10-tetramethylundecane-5,5-diol |
|---|---|
| PubChem CID | 141261588 |
| Molecular Formula | C15H32O2 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.24 |
| IUPAC Name | 2,6,6,10-tetramethylundecane-5,5-diol |
| SMILES | CC(C)CCCC(C)(C)C(O)(O)CCC(C)C |
| InChI | InChI=1S/C15H32O2/c1-12(2)8-7-10-14(5,6)15(16,17)11-9-13(3)4/h12-13,16-17H,7-11H2,1-6H3 |
| InChIKey | LBZHOGGDFYIHNO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|