C10H17NO2 — CID 141262058
N,N-bis(oxiran-2-ylmethyl)but-2-en-1-amine (PubChem CID 141262058) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is N,N-bis(oxiran-2-ylmethyl)but-2-en-1-amine.
| Compound Name | N,N-bis(oxiran-2-ylmethyl)but-2-en-1-amine |
|---|---|
| PubChem CID | 141262058 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | N,N-bis(oxiran-2-ylmethyl)but-2-en-1-amine |
| SMILES | CC=CCN(CC1CO1)CC1CO1 |
| InChI | InChI=1S/C10H17NO2/c1-2-3-4-11(5-9-7-12-9)6-10-8-13-10/h2-3,9-10H,4-8H2,1H3 |
| InChIKey | JOTWOXIYOHVUFF-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 28.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|