C31H39FN2O3Si — CID 141263524
[2-(2-fluoro-5-methoxy-4-phenylmethoxyphenyl)-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-3-yl]methanol (PubChem CID 141263524) has the molecular formula C31H39FN2O3Si and a molecular weight of 534.75 g/mol. Its IUPAC name is [2-(2-fluoro-5-methoxy-4-phenylmethoxyphenyl)-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-3-yl]methanol.
| Compound Name | [2-(2-fluoro-5-methoxy-4-phenylmethoxyphenyl)-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-3-yl]methanol |
|---|---|
| PubChem CID | 141263524 |
| Molecular Formula | C31H39FN2O3Si |
| Molecular Weight | 534.75 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | [2-(2-fluoro-5-methoxy-4-phenylmethoxyphenyl)-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-3-yl]methanol |
| SMILES | COc1cc(-c2c(CO)c3cccnc3n2[Si](C(C)C)(C(C)C)C(C)C)c(F)cc1OCc1ccccc1 |
| InChI | InChI=1S/C31H39FN2O3Si/c1-20(2)38(21(3)4,22(5)6)34-30(26(18-35)24-14-11-15-33-31(24)34)25-16-28(36-7)29(17-27(25)32)37-19-23-12-9-8-10-13-23/h8-17,20-22,35H,18-19H2,1-7H3 |
| InChIKey | MJANNVHQHCIKLD-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.75 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|