C8H16O6 — CID 141266642
2-ethoxy-3-[2-(2-hydroxyethoxy)ethoxy]oxiran-2-ol (PubChem CID 141266642) has the molecular formula C8H16O6 and a molecular weight of 208.21 g/mol. Its IUPAC name is 2-ethoxy-3-[2-(2-hydroxyethoxy)ethoxy]oxiran-2-ol.
| Compound Name | 2-ethoxy-3-[2-(2-hydroxyethoxy)ethoxy]oxiran-2-ol |
|---|---|
| PubChem CID | 141266642 |
| Molecular Formula | C8H16O6 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 2-ethoxy-3-[2-(2-hydroxyethoxy)ethoxy]oxiran-2-ol |
| SMILES | CCOC1(O)OC1OCCOCCO |
| InChI | InChI=1S/C8H16O6/c1-2-13-8(10)7(14-8)12-6-5-11-4-3-9/h7,9-10H,2-6H2,1H3 |
| InChIKey | KNOLLSFDJBEYBO-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|