C9H16O5 — CID 141343589
3-[2-(2-hydroxyethoxy)ethoxy]-2-prop-2-enyloxiran-2-ol (PubChem CID 141343589) has the molecular formula C9H16O5 and a molecular weight of 204.22 g/mol. Its IUPAC name is 3-[2-(2-hydroxyethoxy)ethoxy]-2-prop-2-enyloxiran-2-ol.
| Compound Name | 3-[2-(2-hydroxyethoxy)ethoxy]-2-prop-2-enyloxiran-2-ol |
|---|---|
| PubChem CID | 141343589 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 3-[2-(2-hydroxyethoxy)ethoxy]-2-prop-2-enyloxiran-2-ol |
| SMILES | C=CCC1(O)OC1OCCOCCO |
| InChI | InChI=1S/C9H16O5/c1-2-3-9(11)8(14-9)13-7-6-12-5-4-10/h2,8,10-11H,1,3-7H2 |
| InChIKey | SLSPIMKQQNNPAF-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|