C20H22N2O2 — CID 141266678
1'-[[(2R)-oxolan-2-yl]methyl]spiro[2H-1-benzofuran-3,3'-2H-indole]-6-amine (PubChem CID 141266678) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 1'-[[(2R)-oxolan-2-yl]methyl]spiro[2H-1-benzofuran-3,3'-2H-indole]-6-amine.
| Compound Name | 1'-[[(2R)-oxolan-2-yl]methyl]spiro[2H-1-benzofuran-3,3'-2H-indole]-6-amine |
|---|---|
| PubChem CID | 141266678 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 1'-[[(2R)-oxolan-2-yl]methyl]spiro[2H-1-benzofuran-3,3'-2H-indole]-6-amine |
| SMILES | Nc1ccc2c(c1)OCC21CN(C[C@H]2CCCO2)c2ccccc21 |
| InChI | InChI=1S/C20H22N2O2/c21-14-7-8-17-19(10-14)24-13-20(17)12-22(11-15-4-3-9-23-15)18-6-2-1-5-16(18)20/h1-2,5-8,10,15H,3-4,9,11-13,21H2/t15-,20?/m1/s1 |
| InChIKey | BKHARYKYKVEBOJ-IWPPFLRJSA-N |
| XLogP | 2.95 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|