C22H25NO3 — CID 90802978
(3R)-1-pentylspiro[2H-indole-3,8'-3,7-dihydro-2H-furo[2,3-g][1,4]benzodioxine] (PubChem CID 90802978) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is (3R)-1-pentylspiro[2H-indole-3,8'-3,7-dihydro-2H-furo[2,3-g][1,4]benzodioxine].
| Compound Name | (3R)-1-pentylspiro[2H-indole-3,8'-3,7-dihydro-2H-furo[2,3-g][1,4]benzodioxine] |
|---|---|
| PubChem CID | 90802978 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | (3R)-1-pentylspiro[2H-indole-3,8'-3,7-dihydro-2H-furo[2,3-g][1,4]benzodioxine] |
| SMILES | CCCCCN1C[C@@]2(COc3cc4c(cc32)OCCO4)c2ccccc21 |
| InChI | InChI=1S/C22H25NO3/c1-2-3-6-9-23-14-22(16-7-4-5-8-18(16)23)15-26-19-13-21-20(12-17(19)22)24-10-11-25-21/h4-5,7-8,12-13H,2-3,6,9-11,14-15H2,1H3/t22-/m1/s1 |
| InChIKey | BRSRYLHIMDWPRF-JOCHJYFZSA-N |
| XLogP | 4.15 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|