C15H24FN5 — CID 141267635
N-(fluoromethyl)-6-(3,5,5-trimethylhexyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 141267635) has the molecular formula C15H24FN5 and a molecular weight of 293.39 g/mol. Its IUPAC name is N-(fluoromethyl)-6-(3,5,5-trimethylhexyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-(fluoromethyl)-6-(3,5,5-trimethylhexyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 141267635 |
| Molecular Formula | C15H24FN5 |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | N-(fluoromethyl)-6-(3,5,5-trimethylhexyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CC(CCc1cnc2ncnn2c1NCF)CC(C)(C)C |
| InChI | InChI=1S/C15H24FN5/c1-11(7-15(2,3)4)5-6-12-8-17-14-19-10-20-21(14)13(12)18-9-16/h8,10-11,18H,5-7,9H2,1-4H3 |
| InChIKey | JMWCBBPJDDRJMB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|