C15H22F3N5 — CID 142791630
N-(trifluoromethyl)-6-(3,5,5-trimethylhexyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 142791630) has the molecular formula C15H22F3N5 and a molecular weight of 329.37 g/mol. Its IUPAC name is N-(trifluoromethyl)-6-(3,5,5-trimethylhexyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-(trifluoromethyl)-6-(3,5,5-trimethylhexyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 142791630 |
| Molecular Formula | C15H22F3N5 |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | N-(trifluoromethyl)-6-(3,5,5-trimethylhexyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CC(CCc1cnc2ncnn2c1NC(F)(F)F)CC(C)(C)C |
| InChI | InChI=1S/C15H22F3N5/c1-10(7-14(2,3)4)5-6-11-8-19-13-20-9-21-23(13)12(11)22-15(16,17)18/h8-10,22H,5-7H2,1-4H3 |
| InChIKey | JRRDHKYEUFIEIT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|