[4-[(heptylamino)methylamino]butylamino] hydrogen carbonate

C13H29N3O3 — CID 141268491

IUPAC[4-[(heptylamino)methylamino]butylamino] hydrogen carbonate
SMILESCCCCCCCNCNCCCCNOC(=O)O
InChIInChI=1S/C13H29N3O3/c1-2-3-4-5-6-9-14-12-15-10-7-8-11-16-19-13(17)18/h14-16H,2-12H2,1H3,(H,17,18)
InChIKeyVKZXIHIQDHGEAP-UHFFFAOYSA-N
MW275.39 g/mol
LogP2.07
Rot. Bonds14

About [4-[(heptylamino)methylamino]butylamino] hydrogen carbonate

[4-[(heptylamino)methylamino]butylamino] hydrogen carbonate (PubChem CID 141268491) has the molecular formula C13H29N3O3 and a molecular weight of 275.39 g/mol. Its IUPAC name is [4-[(heptylamino)methylamino]butylamino] hydrogen carbonate.

Molecular Properties

Compound Name[4-[(heptylamino)methylamino]butylamino] hydrogen carbonate
PubChem CID141268491
Molecular FormulaC13H29N3O3
Molecular Weight275.39 g/mol
Exact Mass275.22
IUPAC Name[4-[(heptylamino)methylamino]butylamino] hydrogen carbonate
SMILESCCCCCCCNCNCCCCNOC(=O)O
InChIInChI=1S/C13H29N3O3/c1-2-3-4-5-6-9-14-12-15-10-7-8-11-16-19-13(17)18/h14-16H,2-12H2,1H3,(H,17,18)
InChIKeyVKZXIHIQDHGEAP-UHFFFAOYSA-N
XLogP2.07
TPSA82.62 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds14
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.39
LogP ≤ 52.07
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze [4-[(heptylamino)methylamino]butylamino] hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [4-[(heptylamino)methylamino]butylamino] hydrogen carbonate?
The IUPAC name of [4-[(heptylamino)methylamino]butylamino] hydrogen carbonate (CID 141268491) is [4-[(heptylamino)methylamino]butylamino] hydrogen carbonate.
What is the SMILES notation for [4-[(heptylamino)methylamino]butylamino] hydrogen carbonate?
The canonical SMILES for [4-[(heptylamino)methylamino]butylamino] hydrogen carbonate is CCCCCCCNCNCCCCNOC(=O)O.
What is the InChIKey of [4-[(heptylamino)methylamino]butylamino] hydrogen carbonate?
The InChIKey is VKZXIHIQDHGEAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29N3O3/c1-2-3-4-5-6-9-14-12-15-10-7-8-11-16-19-13(17)18/h14-16H,2-12H2,1H3,(H,17,18).
What are the key properties of [4-[(heptylamino)methylamino]butylamino] hydrogen carbonate?
[4-[(heptylamino)methylamino]butylamino] hydrogen carbonate has a molecular weight of 275.39 g/mol, XLogP of 2.07, 14 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(heptylamino)methylamino]butylamino] hydrogen carbonate is sourced from PubChem (CID 141268491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).