C17H25NO3S — CID 141268685
4-[(1R,2S)-2-[2-(4-methylsulfonylphenoxy)ethyl]cyclopropyl]piperidine (PubChem CID 141268685) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is 4-[(1R,2S)-2-[2-(4-methylsulfonylphenoxy)ethyl]cyclopropyl]piperidine.
| Compound Name | 4-[(1R,2S)-2-[2-(4-methylsulfonylphenoxy)ethyl]cyclopropyl]piperidine |
|---|---|
| PubChem CID | 141268685 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 4-[(1R,2S)-2-[2-(4-methylsulfonylphenoxy)ethyl]cyclopropyl]piperidine |
| SMILES | CS(=O)(=O)c1ccc(OCC[C@@H]2C[C@@H]2C2CCNCC2)cc1 |
| InChI | InChI=1S/C17H25NO3S/c1-22(19,20)16-4-2-15(3-5-16)21-11-8-14-12-17(14)13-6-9-18-10-7-13/h2-5,13-14,17-18H,6-12H2,1H3/t14-,17-/m1/s1 |
| InChIKey | CKMWOZCUGPWCHJ-RHSMWYFYSA-N |
| XLogP | 2.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |