C21H20FN3OS — CID 141269901
(4-fluorophenyl)-[(3S)-3-(3-phenylsulfanyl-1H-pyrazol-5-yl)piperidin-1-yl]methanone (PubChem CID 141269901) has the molecular formula C21H20FN3OS and a molecular weight of 381.48 g/mol. Its IUPAC name is (4-fluorophenyl)-[(3S)-3-(3-phenylsulfanyl-1H-pyrazol-5-yl)piperidin-1-yl]methanone.
| Compound Name | (4-fluorophenyl)-[(3S)-3-(3-phenylsulfanyl-1H-pyrazol-5-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 141269901 |
| Molecular Formula | C21H20FN3OS |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | (4-fluorophenyl)-[(3S)-3-(3-phenylsulfanyl-1H-pyrazol-5-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1)N1CCC[C@H](c2cc(Sc3ccccc3)n[nH]2)C1 |
| InChI | InChI=1S/C21H20FN3OS/c22-17-10-8-15(9-11-17)21(26)25-12-4-5-16(14-25)19-13-20(24-23-19)27-18-6-2-1-3-7-18/h1-3,6-11,13,16H,4-5,12,14H2,(H,23,24)/t16-/m0/s1 |
| InChIKey | JZDOUTQXGLXCQZ-INIZCTEOSA-N |
| XLogP | 4.72 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |