C19H24FN3O2 — CID 141272113
N-[3-[1-amino-3-(dimethylamino)propyl]phenyl]-3-fluoro-4-methoxybenzamide (PubChem CID 141272113) has the molecular formula C19H24FN3O2 and a molecular weight of 345.42 g/mol. Its IUPAC name is N-[3-[1-amino-3-(dimethylamino)propyl]phenyl]-3-fluoro-4-methoxybenzamide.
| Compound Name | N-[3-[1-amino-3-(dimethylamino)propyl]phenyl]-3-fluoro-4-methoxybenzamide |
|---|---|
| PubChem CID | 141272113 |
| Molecular Formula | C19H24FN3O2 |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | N-[3-[1-amino-3-(dimethylamino)propyl]phenyl]-3-fluoro-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(C(N)CCN(C)C)c2)cc1F |
| InChI | InChI=1S/C19H24FN3O2/c1-23(2)10-9-17(21)13-5-4-6-15(11-13)22-19(24)14-7-8-18(25-3)16(20)12-14/h4-8,11-12,17H,9-10,21H2,1-3H3,(H,22,24) |
| InChIKey | XKGSVJAXDLVIMB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |