C33H60O3Si — CID 141272310
[(6R)-6-[(8S,9S,10S,13R,14S,17R)-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptyl]-triethoxysilane (PubChem CID 141272310) has the molecular formula C33H60O3Si and a molecular weight of 532.93 g/mol. Its IUPAC name is [(6R)-6-[(8S,9S,10S,13R,14S,17R)-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptyl]-triethoxysilane.
| Compound Name | [(6R)-6-[(8S,9S,10S,13R,14S,17R)-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptyl]-triethoxysilane |
|---|---|
| PubChem CID | 141272310 |
| Molecular Formula | C33H60O3Si |
| Molecular Weight | 532.93 g/mol |
| Exact Mass | 532.43 |
| IUPAC Name | [(6R)-6-[(8S,9S,10S,13R,14S,17R)-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptyl]-triethoxysilane |
| SMILES | CCO[Si](CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4C=CCC[C@]4(C)[C@H]3CC[C@]12C)(OCC)OCC |
| InChI | InChI=1S/C33H60O3Si/c1-8-34-37(35-9-2,36-10-3)24-25(4)14-13-15-26(5)29-19-20-30-28-18-17-27-16-11-12-22-32(27,6)31(28)21-23-33(29,30)7/h11,16,25-31H,8-10,12-15,17-24H2,1-7H3/t25?,26-,27?,28+,29-,30+,31+,32+,33-/m1/s1 |
| InChIKey | TWYLPHSVZUZZDD-GKUPZEQZSA-N |
| XLogP | 9.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.93 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|