C25H24N2O6S — CID 141273176
1-[2-acetyl-4-[2-(furan-2-yl)acetyl]-3-(2-thiophen-2-ylacetyl)morpholin-3-yl]-2-pyridin-4-ylethanone (PubChem CID 141273176) has the molecular formula C25H24N2O6S and a molecular weight of 480.54 g/mol. Its IUPAC name is 1-[2-acetyl-4-[2-(furan-2-yl)acetyl]-3-(2-thiophen-2-ylacetyl)morpholin-3-yl]-2-pyridin-4-ylethanone.
| Compound Name | 1-[2-acetyl-4-[2-(furan-2-yl)acetyl]-3-(2-thiophen-2-ylacetyl)morpholin-3-yl]-2-pyridin-4-ylethanone |
|---|---|
| PubChem CID | 141273176 |
| Molecular Formula | C25H24N2O6S |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 1-[2-acetyl-4-[2-(furan-2-yl)acetyl]-3-(2-thiophen-2-ylacetyl)morpholin-3-yl]-2-pyridin-4-ylethanone |
| SMILES | CC(=O)C1OCCN(C(=O)Cc2ccco2)C1(C(=O)Cc1ccncc1)C(=O)Cc1cccs1 |
| InChI | InChI=1S/C25H24N2O6S/c1-17(28)24-25(22(30)16-20-5-3-13-34-20,21(29)14-18-6-8-26-9-7-18)27(10-12-33-24)23(31)15-19-4-2-11-32-19/h2-9,11,13,24H,10,12,14-16H2,1H3 |
| InChIKey | RHTIKHXJRMVPAJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 106.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|