C19H17NO4 — CID 141273478
2-[3-(4-phenylmethoxyphenyl)-1,2-oxazol-5-yl]ethyl formate (PubChem CID 141273478) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is 2-[3-(4-phenylmethoxyphenyl)-1,2-oxazol-5-yl]ethyl formate.
| Compound Name | 2-[3-(4-phenylmethoxyphenyl)-1,2-oxazol-5-yl]ethyl formate |
|---|---|
| PubChem CID | 141273478 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 2-[3-(4-phenylmethoxyphenyl)-1,2-oxazol-5-yl]ethyl formate |
| SMILES | O=COCCc1cc(-c2ccc(OCc3ccccc3)cc2)no1 |
| InChI | InChI=1S/C19H17NO4/c21-14-22-11-10-18-12-19(20-24-18)16-6-8-17(9-7-16)23-13-15-4-2-1-3-5-15/h1-9,12,14H,10-11,13H2 |
| InChIKey | BNRWFRYGZPVHKH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|