C8H6FN3O2 — CID 141273810
5-fluoro-3-(1H-pyrrol-2-yl)-1H-pyrimidine-2,4-dione (PubChem CID 141273810) has the molecular formula C8H6FN3O2 and a molecular weight of 195.15 g/mol. Its IUPAC name is 5-fluoro-3-(1H-pyrrol-2-yl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-3-(1H-pyrrol-2-yl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 141273810 |
| Molecular Formula | C8H6FN3O2 |
| Molecular Weight | 195.15 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 5-fluoro-3-(1H-pyrrol-2-yl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]cc(F)c(=O)n1-c1ccc[nH]1 |
| InChI | InChI=1S/C8H6FN3O2/c9-5-4-11-8(14)12(7(5)13)6-2-1-3-10-6/h1-4,10H,(H,11,14) |
| InChIKey | AOEJNHDIYMSDCO-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.15 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |