C29H26ClN3O — CID 141274138
[5-(4-chloro-N-methylanilino)-2-pyridinyl]-[3-[N-(cyclopropylmethyl)anilino]phenyl]methanone (PubChem CID 141274138) has the molecular formula C29H26ClN3O and a molecular weight of 468.00 g/mol. Its IUPAC name is [5-(4-chloro-N-methylanilino)-2-pyridinyl]-[3-[N-(cyclopropylmethyl)anilino]phenyl]methanone.
| Compound Name | [5-(4-chloro-N-methylanilino)-2-pyridinyl]-[3-[N-(cyclopropylmethyl)anilino]phenyl]methanone |
|---|---|
| PubChem CID | 141274138 |
| Molecular Formula | C29H26ClN3O |
| Molecular Weight | 468.00 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | [5-(4-chloro-N-methylanilino)-2-pyridinyl]-[3-[N-(cyclopropylmethyl)anilino]phenyl]methanone |
| SMILES | CN(c1ccc(Cl)cc1)c1ccc(C(=O)c2cccc(N(CC3CC3)c3ccccc3)c2)nc1 |
| InChI | InChI=1S/C29H26ClN3O/c1-32(24-14-12-23(30)13-15-24)27-16-17-28(31-19-27)29(34)22-6-5-9-26(18-22)33(20-21-10-11-21)25-7-3-2-4-8-25/h2-9,12-19,21H,10-11,20H2,1H3 |
| InChIKey | FJEDZRIDNAEZMT-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.00 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|