C24H50N2O2 — CID 141274919
N,2-diethyl-3-methyl-2-propan-2-ylbutanamide (PubChem CID 141274919) has the molecular formula C24H50N2O2 and a molecular weight of 398.68 g/mol. Its IUPAC name is N,2-diethyl-3-methyl-2-propan-2-ylbutanamide.
| Compound Name | N,2-diethyl-3-methyl-2-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 141274919 |
| Molecular Formula | C24H50N2O2 |
| Molecular Weight | 398.68 g/mol |
| Exact Mass | 398.39 |
| IUPAC Name | N,2-diethyl-3-methyl-2-propan-2-ylbutanamide |
| SMILES | CCNC(=O)C(CC)(C(C)C)C(C)C.CCNC(=O)C(CC)(C(C)C)C(C)C |
| InChI | InChI=1S/2C12H25NO/c2*1-7-12(9(3)4,10(5)6)11(14)13-8-2/h2*9-10H,7-8H2,1-6H3,(H,13,14) |
| InChIKey | WIVKUUJHEXFFRN-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.68 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |