C6H7F4NO3 — CID 142578777
4-(ethylamino)-2,2,3,3-tetrafluoro-4-oxobutanoic acid (PubChem CID 142578777) has the molecular formula C6H7F4NO3 and a molecular weight of 217.12 g/mol. Its IUPAC name is 4-(ethylamino)-2,2,3,3-tetrafluoro-4-oxobutanoic acid.
| Compound Name | 4-(ethylamino)-2,2,3,3-tetrafluoro-4-oxobutanoic acid |
|---|---|
| PubChem CID | 142578777 |
| Molecular Formula | C6H7F4NO3 |
| Molecular Weight | 217.12 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 4-(ethylamino)-2,2,3,3-tetrafluoro-4-oxobutanoic acid |
| SMILES | CCNC(=O)C(F)(F)C(F)(F)C(=O)O |
| InChI | InChI=1S/C6H7F4NO3/c1-2-11-3(12)5(7,8)6(9,10)4(13)14/h2H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | AVUKWZZVBPUTHB-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.12 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|