C14H23F4NO3 — CID 155110950
4-(5-ethyloctan-2-ylamino)-2,2,3,3-tetrafluoro-4-oxobutanoic acid (PubChem CID 155110950) has the molecular formula C14H23F4NO3 and a molecular weight of 329.33 g/mol. Its IUPAC name is 4-(5-ethyloctan-2-ylamino)-2,2,3,3-tetrafluoro-4-oxobutanoic acid.
| Compound Name | 4-(5-ethyloctan-2-ylamino)-2,2,3,3-tetrafluoro-4-oxobutanoic acid |
|---|---|
| PubChem CID | 155110950 |
| Molecular Formula | C14H23F4NO3 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 4-(5-ethyloctan-2-ylamino)-2,2,3,3-tetrafluoro-4-oxobutanoic acid |
| SMILES | CCCC(CC)CCC(C)NC(=O)C(F)(F)C(F)(F)C(=O)O |
| InChI | InChI=1S/C14H23F4NO3/c1-4-6-10(5-2)8-7-9(3)19-11(20)13(15,16)14(17,18)12(21)22/h9-10H,4-8H2,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | YHIBMYBYLDETDI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|